C25H29F3N5O5P — CID 58292991
2-[[2-[4-[diethoxyphosphoryl(methoxy)methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 58292991) has the molecular formula C25H29F3N5O5P and a molecular weight of 567.51 g/mol. Its IUPAC name is 2-[[2-[4-[diethoxyphosphoryl(methoxy)methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[2-[4-[diethoxyphosphoryl(methoxy)methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 58292991 |
| Molecular Formula | C25H29F3N5O5P |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 2-[[2-[4-[diethoxyphosphoryl(methoxy)methyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | CCOP(=O)(OCC)C(OC)c1ccc(Nc2ncc(C(F)(F)F)c(Nc3ccccc3C(=O)NC)n2)cc1 |
| InChI | InChI=1S/C25H29F3N5O5P/c1-5-37-39(35,38-6-2)23(36-4)16-11-13-17(14-12-16)31-24-30-15-19(25(26,27)28)21(33-24)32-20-10-8-7-9-18(20)22(34)29-3/h7-15,23H,5-6H2,1-4H3,(H,29,34)(H2,30,31,32,33) |
| InChIKey | CHLFUTBEYBHAPY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 123.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|