C20H18F4N5O4P — CID 67480577
[fluoro-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl]phosphonic acid (PubChem CID 67480577) has the molecular formula C20H18F4N5O4P and a molecular weight of 499.36 g/mol. Its IUPAC name is [fluoro-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl]phosphonic acid.
| Compound Name | [fluoro-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 67480577 |
| Molecular Formula | C20H18F4N5O4P |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | [fluoro-[4-[[4-[2-(methylcarbamoyl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]methyl]phosphonic acid |
| SMILES | CNC(=O)c1ccccc1Nc1nc(Nc2ccc(C(F)P(=O)(O)O)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C20H18F4N5O4P/c1-25-18(30)13-4-2-3-5-15(13)28-17-14(20(22,23)24)10-26-19(29-17)27-12-8-6-11(7-9-12)16(21)34(31,32)33/h2-10,16H,1H3,(H,25,30)(H2,31,32,33)(H2,26,27,28,29) |
| InChIKey | YMSDSAUIIVGZEQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|