C26H31F3N5O6P — CID 58292955
2-[[2-[4-[bis(2-methoxyethoxy)phosphorylmethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 58292955) has the molecular formula C26H31F3N5O6P and a molecular weight of 597.53 g/mol. Its IUPAC name is 2-[[2-[4-[bis(2-methoxyethoxy)phosphorylmethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[2-[4-[bis(2-methoxyethoxy)phosphorylmethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 58292955 |
| Molecular Formula | C26H31F3N5O6P |
| Molecular Weight | 597.53 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | 2-[[2-[4-[bis(2-methoxyethoxy)phosphorylmethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Nc1nc(Nc2ccc(CP(=O)(OCCOC)OCCOC)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H31F3N5O6P/c1-30-24(35)20-6-4-5-7-22(20)33-23-21(26(27,28)29)16-31-25(34-23)32-19-10-8-18(9-11-19)17-41(36,39-14-12-37-2)40-15-13-38-3/h4-11,16H,12-15,17H2,1-3H3,(H,30,35)(H2,31,32,33,34) |
| InChIKey | DHULDLHSZCBRRQ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.53 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|