C26H29F3N5O6P — CID 167237149
7-[[4-(2-dimethoxyphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(2-methylpropoxy)-2,3-dihydro-1-benzofuran-4-carboxamide (PubChem CID 167237149) has the molecular formula C26H29F3N5O6P and a molecular weight of 595.52 g/mol. Its IUPAC name is 7-[[4-(2-dimethoxyphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(2-methylpropoxy)-2,3-dihydro-1-benzofuran-4-carboxamide.
| Compound Name | 7-[[4-(2-dimethoxyphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(2-methylpropoxy)-2,3-dihydro-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 167237149 |
| Molecular Formula | C26H29F3N5O6P |
| Molecular Weight | 595.52 g/mol |
| Exact Mass | 595.18 |
| IUPAC Name | 7-[[4-(2-dimethoxyphosphorylanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]-N-(2-methylpropoxy)-2,3-dihydro-1-benzofuran-4-carboxamide |
| SMILES | COP(=O)(OC)c1ccccc1Nc1nc(Nc2ccc(C(=O)NOCC(C)C)c3c2OCC3)ncc1C(F)(F)F |
| InChI | InChI=1S/C26H29F3N5O6P/c1-15(2)14-40-34-24(35)17-9-10-20(22-16(17)11-12-39-22)32-25-30-13-18(26(27,28)29)23(33-25)31-19-7-5-6-8-21(19)41(36,37-3)38-4/h5-10,13,15H,11-12,14H2,1-4H3,(H,34,35)(H2,30,31,32,33) |
| InChIKey | YCRLTGIDZWIOFJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|