C25H26F4N5O6P — CID 167237132
2-fluoro-5-methoxy-N-(2-methylpropoxy)-4-[[4-[2-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide (PubChem CID 167237132) has the molecular formula C25H26F4N5O6P and a molecular weight of 599.48 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-N-(2-methylpropoxy)-4-[[4-[2-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide.
| Compound Name | 2-fluoro-5-methoxy-N-(2-methylpropoxy)-4-[[4-[2-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 167237132 |
| Molecular Formula | C25H26F4N5O6P |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 599.16 |
| IUPAC Name | 2-fluoro-5-methoxy-N-(2-methylpropoxy)-4-[[4-[2-(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)anilino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]benzamide |
| SMILES | COc1cc(C(=O)NOCC(C)C)c(F)cc1Nc1ncc(C(F)(F)F)c(Nc2ccccc2P2(=O)OCCO2)n1 |
| InChI | InChI=1S/C25H26F4N5O6P/c1-14(2)13-38-34-23(35)15-10-20(37-3)19(11-17(15)26)32-24-30-12-16(25(27,28)29)22(33-24)31-18-6-4-5-7-21(18)41(36)39-8-9-40-41/h4-7,10-12,14H,8-9,13H2,1-3H3,(H,34,35)(H2,30,31,32,33) |
| InChIKey | VWHSXRRBGVIBDD-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|