C28H33ClN5O4P — CID 175548324
7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-N-[3-(2-methylpropoxy)prop-1-enyl]-2,3-dihydro-1-benzofuran-4-carboxamide (PubChem CID 175548324) has the molecular formula C28H33ClN5O4P and a molecular weight of 570.03 g/mol. Its IUPAC name is 7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-N-[3-(2-methylpropoxy)prop-1-enyl]-2,3-dihydro-1-benzofuran-4-carboxamide.
| Compound Name | 7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-N-[3-(2-methylpropoxy)prop-1-enyl]-2,3-dihydro-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 175548324 |
| Molecular Formula | C28H33ClN5O4P |
| Molecular Weight | 570.03 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 7-[[5-chloro-4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-N-[3-(2-methylpropoxy)prop-1-enyl]-2,3-dihydro-1-benzofuran-4-carboxamide |
| SMILES | CC(C)COCC=CNC(=O)c1ccc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)c2c1CCO2 |
| InChI | InChI=1S/C28H33ClN5O4P/c1-18(2)17-37-14-7-13-30-27(35)20-10-11-23(25-19(20)12-15-38-25)33-28-31-16-21(29)26(34-28)32-22-8-5-6-9-24(22)39(3,4)36/h5-11,13,16,18H,12,14-15,17H2,1-4H3,(H,30,35)(H2,31,32,33,34) |
| InChIKey | ZUEFFXBAVDAQFZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.03 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|