C13H12Cl3N3O2S — CID 142742089
2,5-dichloro-N-(3-chloro-2-propan-2-ylsulfonylphenyl)pyrimidin-4-amine (PubChem CID 142742089) has the molecular formula C13H12Cl3N3O2S and a molecular weight of 380.68 g/mol. Its IUPAC name is 2,5-dichloro-N-(3-chloro-2-propan-2-ylsulfonylphenyl)pyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-(3-chloro-2-propan-2-ylsulfonylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 142742089 |
| Molecular Formula | C13H12Cl3N3O2S |
| Molecular Weight | 380.68 g/mol |
| Exact Mass | 378.97 |
| IUPAC Name | 2,5-dichloro-N-(3-chloro-2-propan-2-ylsulfonylphenyl)pyrimidin-4-amine |
| SMILES | CC(C)S(=O)(=O)c1c(Cl)cccc1Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C13H12Cl3N3O2S/c1-7(2)22(20,21)11-8(14)4-3-5-10(11)18-12-9(15)6-17-13(16)19-12/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | RWALCDJGBXJJGY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.68 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |