C14H12Cl2N4O2S — CID 155291869
3-[(2,5-dichloropyrimidin-4-yl)amino]-4-propan-2-ylsulfonylbenzonitrile (PubChem CID 155291869) has the molecular formula C14H12Cl2N4O2S and a molecular weight of 371.25 g/mol. Its IUPAC name is 3-[(2,5-dichloropyrimidin-4-yl)amino]-4-propan-2-ylsulfonylbenzonitrile.
| Compound Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]-4-propan-2-ylsulfonylbenzonitrile |
|---|---|
| PubChem CID | 155291869 |
| Molecular Formula | C14H12Cl2N4O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | 3-[(2,5-dichloropyrimidin-4-yl)amino]-4-propan-2-ylsulfonylbenzonitrile |
| SMILES | CC(C)S(=O)(=O)c1ccc(C#N)cc1Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C14H12Cl2N4O2S/c1-8(2)23(21,22)12-4-3-9(6-17)5-11(12)19-13-10(15)7-18-14(16)20-13/h3-5,7-8H,1-2H3,(H,18,19,20) |
| InChIKey | CUWGVJFJOWAOMY-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |