C14H12Cl2N4O2S — CID 175424607
N-(2,5-dichloropyrimidin-4-yl)-2-methyl-1-methylsulfonylindol-7-amine (PubChem CID 175424607) has the molecular formula C14H12Cl2N4O2S and a molecular weight of 371.25 g/mol. Its IUPAC name is N-(2,5-dichloropyrimidin-4-yl)-2-methyl-1-methylsulfonylindol-7-amine.
| Compound Name | N-(2,5-dichloropyrimidin-4-yl)-2-methyl-1-methylsulfonylindol-7-amine |
|---|---|
| PubChem CID | 175424607 |
| Molecular Formula | C14H12Cl2N4O2S |
| Molecular Weight | 371.25 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | N-(2,5-dichloropyrimidin-4-yl)-2-methyl-1-methylsulfonylindol-7-amine |
| SMILES | Cc1cc2cccc(Nc3nc(Cl)ncc3Cl)c2n1S(C)(=O)=O |
| InChI | InChI=1S/C14H12Cl2N4O2S/c1-8-6-9-4-3-5-11(12(9)20(8)23(2,21)22)18-13-10(15)7-17-14(16)19-13/h3-7H,1-2H3,(H,17,18,19) |
| InChIKey | NTGRPMZLZPORJY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |