C24H23Cl5N8O6S2 — CID 159124840
2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbenzenesulfonamide;N,N-dimethyl-2-nitrobenzenesulfonamide;2,4,5-trichloropyrimidine (PubChem CID 159124840) has the molecular formula C24H23Cl5N8O6S2 and a molecular weight of 760.90 g/mol. Its IUPAC name is 2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbenzenesulfonamide;N,N-dimethyl-2-nitrobenzenesulfonamide;2,4,5-trichloropyrimidine.
| Compound Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbenzenesulfonamide;N,N-dimethyl-2-nitrobenzenesulfonamide;2,4,5-trichloropyrimidine |
|---|---|
| PubChem CID | 159124840 |
| Molecular Formula | C24H23Cl5N8O6S2 |
| Molecular Weight | 760.90 g/mol |
| Exact Mass | 757.96 |
| IUPAC Name | 2-[(2,5-dichloropyrimidin-4-yl)amino]-N,N-dimethylbenzenesulfonamide;N,N-dimethyl-2-nitrobenzenesulfonamide;2,4,5-trichloropyrimidine |
| SMILES | CN(C)S(=O)(=O)c1ccccc1Nc1nc(Cl)ncc1Cl.CN(C)S(=O)(=O)c1ccccc1[N+](=O)[O-].Clc1ncc(Cl)c(Cl)n1 |
| InChI | InChI=1S/C12H12Cl2N4O2S.C8H10N2O4S.C4HCl3N2/c1-18(2)21(19,20)10-6-4-3-5-9(10)16-11-8(13)7-15-12(14)17-11;1-9(2)15(13,14)8-6-4-3-5-7(8)10(11)12;5-2-1-8-4(7)9-3(2)6/h3-7H,1-2H3,(H,15,16,17);3-6H,1-2H3;1H |
| InChIKey | KGDNSFDYEUNILU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 181.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.90 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|