C13H14ClN5O3S — CID 59284569
4-chloro-N-(2-morpholin-4-ylsulfonylphenyl)-1,3,5-triazin-2-amine (PubChem CID 59284569) has the molecular formula C13H14ClN5O3S and a molecular weight of 355.81 g/mol. Its IUPAC name is 4-chloro-N-(2-morpholin-4-ylsulfonylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(2-morpholin-4-ylsulfonylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 59284569 |
| Molecular Formula | C13H14ClN5O3S |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 4-chloro-N-(2-morpholin-4-ylsulfonylphenyl)-1,3,5-triazin-2-amine |
| SMILES | O=S(=O)(c1ccccc1Nc1ncnc(Cl)n1)N1CCOCC1 |
| InChI | InChI=1S/C13H14ClN5O3S/c14-12-15-9-16-13(18-12)17-10-3-1-2-4-11(10)23(20,21)19-5-7-22-8-6-19/h1-4,9H,5-8H2,(H,15,16,17,18) |
| InChIKey | NKTQPOHOAIOLJX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |