C10H9Cl2N3 — CID 143899900
2,5-dichloro-N-cyclohexa-1,3-dien-1-ylpyrimidin-4-amine (PubChem CID 143899900) has the molecular formula C10H9Cl2N3 and a molecular weight of 242.11 g/mol. Its IUPAC name is 2,5-dichloro-N-cyclohexa-1,3-dien-1-ylpyrimidin-4-amine.
| Compound Name | 2,5-dichloro-N-cyclohexa-1,3-dien-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 143899900 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2,5-dichloro-N-cyclohexa-1,3-dien-1-ylpyrimidin-4-amine |
| SMILES | Clc1ncc(Cl)c(NC2=CC=CCC2)n1 |
| InChI | InChI=1S/C10H9Cl2N3/c11-8-6-13-10(12)15-9(8)14-7-4-2-1-3-5-7/h1-2,4,6H,3,5H2,(H,13,14,15) |
| InChIKey | YBPJKQPCRCTNLQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |