C12H10BrCl2N3 — CID 79632109
N-(4-bromo-2,6-dimethylphenyl)-2,5-dichloropyrimidin-4-amine (PubChem CID 79632109) has the molecular formula C12H10BrCl2N3 and a molecular weight of 347.04 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2,5-dichloropyrimidin-4-amine.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2,5-dichloropyrimidin-4-amine |
|---|---|
| PubChem CID | 79632109 |
| Molecular Formula | C12H10BrCl2N3 |
| Molecular Weight | 347.04 g/mol |
| Exact Mass | 344.94 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2,5-dichloropyrimidin-4-amine |
| SMILES | Cc1cc(Br)cc(C)c1Nc1nc(Cl)ncc1Cl |
| InChI | InChI=1S/C12H10BrCl2N3/c1-6-3-8(13)4-7(2)10(6)17-11-9(14)5-16-12(15)18-11/h3-5H,1-2H3,(H,16,17,18) |
| InChIKey | KYYDPATUTOUXQC-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.04 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |