C13H16BrN5 — CID 80930862
N-(4-bromo-2,6-dimethylphenyl)-2-hydrazinyl-5-methylpyrimidin-4-amine (PubChem CID 80930862) has the molecular formula C13H16BrN5 and a molecular weight of 322.21 g/mol. Its IUPAC name is N-(4-bromo-2,6-dimethylphenyl)-2-hydrazinyl-5-methylpyrimidin-4-amine.
| Compound Name | N-(4-bromo-2,6-dimethylphenyl)-2-hydrazinyl-5-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80930862 |
| Molecular Formula | C13H16BrN5 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-(4-bromo-2,6-dimethylphenyl)-2-hydrazinyl-5-methylpyrimidin-4-amine |
| SMILES | Cc1cnc(NN)nc1Nc1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C13H16BrN5/c1-7-4-10(14)5-8(2)11(7)17-12-9(3)6-16-13(18-12)19-15/h4-6H,15H2,1-3H3,(H2,16,17,18,19) |
| InChIKey | WMWZBYKXZHMAGL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|