C13H7Cl3N4 — CID 116785190
5-chloro-N-(2,5-dichloropyrimidin-4-yl)quinolin-8-amine (PubChem CID 116785190) has the molecular formula C13H7Cl3N4 and a molecular weight of 325.59 g/mol. Its IUPAC name is 5-chloro-N-(2,5-dichloropyrimidin-4-yl)quinolin-8-amine.
| Compound Name | 5-chloro-N-(2,5-dichloropyrimidin-4-yl)quinolin-8-amine |
|---|---|
| PubChem CID | 116785190 |
| Molecular Formula | C13H7Cl3N4 |
| Molecular Weight | 325.59 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 5-chloro-N-(2,5-dichloropyrimidin-4-yl)quinolin-8-amine |
| SMILES | Clc1ncc(Cl)c(Nc2ccc(Cl)c3cccnc23)n1 |
| InChI | InChI=1S/C13H7Cl3N4/c14-8-3-4-10(11-7(8)2-1-5-17-11)19-12-9(15)6-18-13(16)20-12/h1-6H,(H,18,19,20) |
| InChIKey | OQEXBQQVJFUUKP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.59 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |