C12H6Cl2N6O2 — CID 168806412
N-(2,5-dichloropyrimidin-4-yl)-5-nitroquinoxalin-6-amine (PubChem CID 168806412) has the molecular formula C12H6Cl2N6O2 and a molecular weight of 337.13 g/mol. Its IUPAC name is N-(2,5-dichloropyrimidin-4-yl)-5-nitroquinoxalin-6-amine.
| Compound Name | N-(2,5-dichloropyrimidin-4-yl)-5-nitroquinoxalin-6-amine |
|---|---|
| PubChem CID | 168806412 |
| Molecular Formula | C12H6Cl2N6O2 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | N-(2,5-dichloropyrimidin-4-yl)-5-nitroquinoxalin-6-amine |
| SMILES | O=[N+]([O-])c1c(Nc2nc(Cl)ncc2Cl)ccc2nccnc12 |
| InChI | InChI=1S/C12H6Cl2N6O2/c13-6-5-17-12(14)19-11(6)18-8-2-1-7-9(10(8)20(21)22)16-4-3-15-7/h1-5H,(H,17,18,19) |
| InChIKey | OKDYUHYZRHQIMM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|