C11H5Cl2N5O2S — CID 165395243
N-(2,5-dichloropyrimidin-4-yl)-4-nitro-1,3-benzothiazol-5-amine (PubChem CID 165395243) has the molecular formula C11H5Cl2N5O2S and a molecular weight of 342.17 g/mol. Its IUPAC name is N-(2,5-dichloropyrimidin-4-yl)-4-nitro-1,3-benzothiazol-5-amine.
| Compound Name | N-(2,5-dichloropyrimidin-4-yl)-4-nitro-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 165395243 |
| Molecular Formula | C11H5Cl2N5O2S |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 340.95 |
| IUPAC Name | N-(2,5-dichloropyrimidin-4-yl)-4-nitro-1,3-benzothiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(Nc2nc(Cl)ncc2Cl)ccc2scnc12 |
| InChI | InChI=1S/C11H5Cl2N5O2S/c12-5-3-14-11(13)17-10(5)16-6-1-2-7-8(15-4-21-7)9(6)18(19)20/h1-4H,(H,14,16,17) |
| InChIKey | ZXSDNYCJSHRMEQ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|