C12H10N4O2S2 — CID 61282016
N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine (PubChem CID 61282016) has the molecular formula C12H10N4O2S2 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine.
| Compound Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 61282016 |
| Molecular Formula | C12H10N4O2S2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-5-yl)methyl]-4-nitro-1,3-benzothiazol-5-amine |
| SMILES | Cc1ncc(CNc2ccc3scnc3c2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H10N4O2S2/c1-7-13-4-8(20-7)5-14-9-2-3-10-11(15-6-19-10)12(9)16(17)18/h2-4,6,14H,5H2,1H3 |
| InChIKey | TYJYWIJEEIICFF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|