C13H15N3O4S — CID 43451189
6-[(4-nitro-1,3-benzothiazol-5-yl)amino]hexanoic acid (PubChem CID 43451189) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 6-[(4-nitro-1,3-benzothiazol-5-yl)amino]hexanoic acid.
| Compound Name | 6-[(4-nitro-1,3-benzothiazol-5-yl)amino]hexanoic acid |
|---|---|
| PubChem CID | 43451189 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 6-[(4-nitro-1,3-benzothiazol-5-yl)amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O4S/c17-11(18)4-2-1-3-7-14-9-5-6-10-12(15-8-21-10)13(9)16(19)20/h5-6,8,14H,1-4,7H2,(H,17,18) |
| InChIKey | QUVRTSPNULENQQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|