C12H13N3O4S — CID 64701754
3-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]butanoic acid (PubChem CID 64701754) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]butanoic acid.
| Compound Name | 3-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 64701754 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-methyl-3-[(4-nitro-1,3-benzothiazol-5-yl)amino]butanoic acid |
| SMILES | CC(C)(CC(=O)O)Nc1ccc2scnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13N3O4S/c1-12(2,5-9(16)17)14-7-3-4-8-10(13-6-20-8)11(7)15(18)19/h3-4,6,14H,5H2,1-2H3,(H,16,17) |
| InChIKey | CRMKGVPISFJHGY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|