C10H8F3N3O2S — CID 63226733
4-nitro-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-5-amine (PubChem CID 63226733) has the molecular formula C10H8F3N3O2S and a molecular weight of 291.25 g/mol. Its IUPAC name is 4-nitro-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-5-amine.
| Compound Name | 4-nitro-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-5-amine |
|---|---|
| PubChem CID | 63226733 |
| Molecular Formula | C10H8F3N3O2S |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 4-nitro-N-(3,3,3-trifluoropropyl)-1,3-benzothiazol-5-amine |
| SMILES | O=[N+]([O-])c1c(NCCC(F)(F)F)ccc2scnc12 |
| InChI | InChI=1S/C10H8F3N3O2S/c11-10(12,13)3-4-14-6-1-2-7-8(15-5-19-7)9(6)16(17)18/h1-2,5,14H,3-4H2 |
| InChIKey | CHNZVXIPIHVYMP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|