About 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate
6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate (PubChem CID 7102134) has the molecular formula C12H13N4O4S-
and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate.
Molecular Properties
| Compound Name | 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate |
| PubChem CID | 7102134 |
| Molecular Formula | C12H13N4O4S- |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate |
| SMILES | O=C([O-])CCCCCNc1ccc2nsnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O4S/c17-10(18)4-2-1-3-7-13-9-6-5-8-11(15-21-14-8)12(9)16(19)20/h5-6,13H,1-4,7H2,(H,17,18)/p-1 |
| InChIKey | OGKMCGKXYXLFMO-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate?
The IUPAC name of 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate (CID 7102134) is 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate.
What is the SMILES notation for 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate?
The canonical SMILES for 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate is O=C([O-])CCCCCNc1ccc2nsnc2c1[N+](=O)[O-].
What is the InChIKey of 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate?
The InChIKey is OGKMCGKXYXLFMO-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H14N4O4S/c17-10(18)4-2-1-3-7-13-9-6-5-8-11(15-21-14-8)12(9)16(19)20/h5-6,13H,1-4,7H2,(H,17,18)/p-1.
What are the key properties of 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate?
6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate has a molecular weight of 309.33 g/mol, XLogP of 1.32, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate is sourced from PubChem (CID 7102134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).