C12H13N4O4S- — CID 7102134
6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate (PubChem CID 7102134) has the molecular formula C12H13N4O4S- and a molecular weight of 309.33 g/mol. Its IUPAC name is 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate.
| Compound Name | 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate |
|---|---|
| PubChem CID | 7102134 |
| Molecular Formula | C12H13N4O4S- |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 6-[(4-nitro-2,1,3-benzothiadiazol-5-yl)amino]hexanoate |
| SMILES | O=C([O-])CCCCCNc1ccc2nsnc2c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O4S/c17-10(18)4-2-1-3-7-13-9-6-5-8-11(15-21-14-8)12(9)16(19)20/h5-6,13H,1-4,7H2,(H,17,18)/p-1 |
| InChIKey | OGKMCGKXYXLFMO-UHFFFAOYSA-M |
| XLogP | 1.32 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|