C11H16N4S — CID 59230508
N'-(2,1,3-benzothiadiazol-4-yl)pentane-1,5-diamine (PubChem CID 59230508) has the molecular formula C11H16N4S and a molecular weight of 236.34 g/mol. Its IUPAC name is N'-(2,1,3-benzothiadiazol-4-yl)pentane-1,5-diamine.
| Compound Name | N'-(2,1,3-benzothiadiazol-4-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 59230508 |
| Molecular Formula | C11H16N4S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | N'-(2,1,3-benzothiadiazol-4-yl)pentane-1,5-diamine |
| SMILES | NCCCCCNc1cccc2nsnc12 |
| InChI | InChI=1S/C11H16N4S/c12-7-2-1-3-8-13-9-5-4-6-10-11(9)15-16-14-10/h4-6,13H,1-3,7-8,12H2 |
| InChIKey | XTIKOAZCAZEALW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|