C7H9N3S — CID 142242922
2,1,3-benzothiadiazol-4-amine;methane (PubChem CID 142242922) has the molecular formula C7H9N3S and a molecular weight of 167.24 g/mol. Its IUPAC name is 2,1,3-benzothiadiazol-4-amine;methane.
| Compound Name | 2,1,3-benzothiadiazol-4-amine;methane |
|---|---|
| PubChem CID | 142242922 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2,1,3-benzothiadiazol-4-amine;methane |
| SMILES | C.Nc1cccc2nsnc12 |
| InChI | InChI=1S/C6H5N3S.CH4/c7-4-2-1-3-5-6(4)9-10-8-5;/h1-3H,7H2;1H4 |
| InChIKey | WPUTVXQMFXDVFF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|