C24H12N6S3 — CID 132539034
4-[2,5-bis(2,1,3-benzothiadiazol-4-yl)phenyl]-2,1,3-benzothiadiazole (PubChem CID 132539034) has the molecular formula C24H12N6S3 and a molecular weight of 480.60 g/mol. Its IUPAC name is 4-[2,5-bis(2,1,3-benzothiadiazol-4-yl)phenyl]-2,1,3-benzothiadiazole.
| Compound Name | 4-[2,5-bis(2,1,3-benzothiadiazol-4-yl)phenyl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 132539034 |
| Molecular Formula | C24H12N6S3 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.03 |
| IUPAC Name | 4-[2,5-bis(2,1,3-benzothiadiazol-4-yl)phenyl]-2,1,3-benzothiadiazole |
| SMILES | c1cc(-c2ccc(-c3cccc4nsnc34)c(-c3cccc4nsnc34)c2)c2nsnc2c1 |
| InChI | InChI=1S/C24H12N6S3/c1-4-14(22-19(7-1)25-31-28-22)13-10-11-15(16-5-2-8-20-23(16)29-32-26-20)18(12-13)17-6-3-9-21-24(17)30-33-27-21/h1-12H |
| InChIKey | BIPCQXWXAHBGRN-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |