C20H24N2S — CID 175140946
4-(3,5-ditert-butylphenyl)-2,1,3-benzothiadiazole (PubChem CID 175140946) has the molecular formula C20H24N2S and a molecular weight of 324.49 g/mol. Its IUPAC name is 4-(3,5-ditert-butylphenyl)-2,1,3-benzothiadiazole.
| Compound Name | 4-(3,5-ditert-butylphenyl)-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 175140946 |
| Molecular Formula | C20H24N2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 4-(3,5-ditert-butylphenyl)-2,1,3-benzothiadiazole |
| SMILES | CC(C)(C)c1cc(-c2cccc3nsnc23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H24N2S/c1-19(2,3)14-10-13(11-15(12-14)20(4,5)6)16-8-7-9-17-18(16)22-23-21-17/h7-12H,1-6H3 |
| InChIKey | KPPLSDIVOCDMKO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |