C14H8IN3S — CID 144923599
[[4-(2,1,3-benzothiadiazol-4-yl)phenyl]methylidene-λ3-iodanyl]formonitrile (PubChem CID 144923599) has the molecular formula C14H8IN3S and a molecular weight of 377.21 g/mol. Its IUPAC name is [[4-(2,1,3-benzothiadiazol-4-yl)phenyl]methylidene-λ3-iodanyl]formonitrile.
| Compound Name | [[4-(2,1,3-benzothiadiazol-4-yl)phenyl]methylidene-λ3-iodanyl]formonitrile |
|---|---|
| PubChem CID | 144923599 |
| Molecular Formula | C14H8IN3S |
| Molecular Weight | 377.21 g/mol |
| Exact Mass | 376.95 |
| IUPAC Name | [[4-(2,1,3-benzothiadiazol-4-yl)phenyl]methylidene-λ3-iodanyl]formonitrile |
| SMILES | N#C/I=C/c1ccc(-c2cccc3nsnc23)cc1 |
| InChI | InChI=1S/C14H8IN3S/c16-9-15-8-10-4-6-11(7-5-10)12-2-1-3-13-14(12)18-19-17-13/h1-8H |
| InChIKey | MIZNEAUIZSWFBH-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|