C42H27N7S3 — CID 141196089
4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]-N,N-bis[4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]phenyl]aniline (PubChem CID 141196089) has the molecular formula C42H27N7S3 and a molecular weight of 725.93 g/mol. Its IUPAC name is 4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]-N,N-bis[4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]phenyl]aniline.
| Compound Name | 4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]-N,N-bis[4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 141196089 |
| Molecular Formula | C42H27N7S3 |
| Molecular Weight | 725.93 g/mol |
| Exact Mass | 725.15 |
| IUPAC Name | 4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]-N,N-bis[4-[2-(2,1,3-benzothiadiazol-4-yl)ethenyl]phenyl]aniline |
| SMILES | C(=Cc1cccc2nsnc12)c1ccc(N(c2ccc(C=Cc3cccc4nsnc34)cc2)c2ccc(C=Cc3cccc4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C42H27N7S3/c1-4-31(40-37(7-1)43-50-46-40)19-10-28-13-22-34(23-14-28)49(35-24-15-29(16-25-35)11-20-32-5-2-8-38-41(32)47-51-44-38)36-26-17-30(18-27-36)12-21-33-6-3-9-39-42(33)48-52-45-39/h1-27H |
| InChIKey | LYNAWRYPYQKWTM-UHFFFAOYSA-N |
| XLogP | 11.68 |
| TPSA | 80.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.93 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|