C48H45NO6 — CID 134974449
4-[2-(2,3-dimethoxyphenyl)ethenyl]-N,N-bis[4-[2-(2,3-dimethoxyphenyl)ethenyl]phenyl]aniline (PubChem CID 134974449) has the molecular formula C48H45NO6 and a molecular weight of 731.89 g/mol. Its IUPAC name is 4-[2-(2,3-dimethoxyphenyl)ethenyl]-N,N-bis[4-[2-(2,3-dimethoxyphenyl)ethenyl]phenyl]aniline.
| Compound Name | 4-[2-(2,3-dimethoxyphenyl)ethenyl]-N,N-bis[4-[2-(2,3-dimethoxyphenyl)ethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 134974449 |
| Molecular Formula | C48H45NO6 |
| Molecular Weight | 731.89 g/mol |
| Exact Mass | 731.32 |
| IUPAC Name | 4-[2-(2,3-dimethoxyphenyl)ethenyl]-N,N-bis[4-[2-(2,3-dimethoxyphenyl)ethenyl]phenyl]aniline |
| SMILES | COc1cccc(C=Cc2ccc(N(c3ccc(C=Cc4cccc(OC)c4OC)cc3)c3ccc(C=Cc4cccc(OC)c4OC)cc3)cc2)c1OC |
| InChI | InChI=1S/C48H45NO6/c1-50-43-13-7-10-37(46(43)53-4)25-16-34-19-28-40(29-20-34)49(41-30-21-35(22-31-41)17-26-38-11-8-14-44(51-2)47(38)54-5)42-32-23-36(24-33-42)18-27-39-12-9-15-45(52-3)48(39)55-6/h7-33H,1-6H3 |
| InChIKey | ASRGZMNXLZEHOT-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.89 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|