C11H14O2S — CID 169456447
3-(2,3-dimethoxyphenyl)prop-2-ene-1-thiol (PubChem CID 169456447) has the molecular formula C11H14O2S and a molecular weight of 210.30 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)prop-2-ene-1-thiol.
| Compound Name | 3-(2,3-dimethoxyphenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169456447 |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)prop-2-ene-1-thiol |
| SMILES | COc1cccc(C=CCS)c1OC |
| InChI | InChI=1S/C11H14O2S/c1-12-10-7-3-5-9(6-4-8-14)11(10)13-2/h3-7,14H,8H2,1-2H3 |
| InChIKey | UXNQURRTRPAFMM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|