C15H10N4OS — CID 167925118
4-(2,1,3-benzothiadiazol-4-yl)-1H-indole-2-carboxamide (PubChem CID 167925118) has the molecular formula C15H10N4OS and a molecular weight of 294.34 g/mol. Its IUPAC name is 4-(2,1,3-benzothiadiazol-4-yl)-1H-indole-2-carboxamide.
| Compound Name | 4-(2,1,3-benzothiadiazol-4-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 167925118 |
| Molecular Formula | C15H10N4OS |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 4-(2,1,3-benzothiadiazol-4-yl)-1H-indole-2-carboxamide |
| SMILES | NC(=O)c1cc2c(-c3cccc4nsnc34)cccc2[nH]1 |
| InChI | InChI=1S/C15H10N4OS/c16-15(20)13-7-10-8(3-1-5-11(10)17-13)9-4-2-6-12-14(9)19-21-18-12/h1-7,17H,(H2,16,20) |
| InChIKey | IDJVPXHFVTVSSK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |