C17H14N4O2S — CID 166606822
ethyl 3-(2,1,3-benzothiadiazol-4-ylamino)-1H-indole-2-carboxylate (PubChem CID 166606822) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is ethyl 3-(2,1,3-benzothiadiazol-4-ylamino)-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-(2,1,3-benzothiadiazol-4-ylamino)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 166606822 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | ethyl 3-(2,1,3-benzothiadiazol-4-ylamino)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1Nc1cccc2nsnc12 |
| InChI | InChI=1S/C17H14N4O2S/c1-2-23-17(22)16-14(10-6-3-4-7-11(10)18-16)19-12-8-5-9-13-15(12)21-24-20-13/h3-9,18-19H,2H2,1H3 |
| InChIKey | ZNXXRQDHFZIYCC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |