C15H20N3O3+ — CID 6954169
[2-[(2-ethoxycarbonyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium (PubChem CID 6954169) has the molecular formula C15H20N3O3+ and a molecular weight of 290.34 g/mol. Its IUPAC name is [2-[(2-ethoxycarbonyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium.
| Compound Name | [2-[(2-ethoxycarbonyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 6954169 |
| Molecular Formula | C15H20N3O3+ |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | [2-[(2-ethoxycarbonyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1NC(=O)C[NH+](C)C |
| InChI | InChI=1S/C15H19N3O3/c1-4-21-15(20)14-13(17-12(19)9-18(2)3)10-7-5-6-8-11(10)16-14/h5-8,16H,4,9H2,1-3H3,(H,17,19)/p+1 |
| InChIKey | GIQZKILDGPDKKW-UHFFFAOYSA-O |
| XLogP | 0.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |