C16H22N3O3+ — CID 3714986
[2-[(2-ethoxycarbonyl-5-methyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium (PubChem CID 3714986) has the molecular formula C16H22N3O3+ and a molecular weight of 304.37 g/mol. Its IUPAC name is [2-[(2-ethoxycarbonyl-5-methyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium.
| Compound Name | [2-[(2-ethoxycarbonyl-5-methyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium |
|---|---|
| PubChem CID | 3714986 |
| Molecular Formula | C16H22N3O3+ |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | [2-[(2-ethoxycarbonyl-5-methyl-1H-indol-3-yl)amino]-2-oxoethyl]-dimethylazanium |
| SMILES | CCOC(=O)c1[nH]c2ccc(C)cc2c1NC(=O)C[NH+](C)C |
| InChI | InChI=1S/C16H21N3O3/c1-5-22-16(21)15-14(18-13(20)9-19(3)4)11-8-10(2)6-7-12(11)17-15/h6-8,17H,5,9H2,1-4H3,(H,18,20)/p+1 |
| InChIKey | YNPCPMLMJNSOTQ-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |