C17H22N3O3S+ — CID 7380780
methyl 5-methyl-3-[(2-thiomorpholin-4-ium-4-ylacetyl)amino]-1H-indole-2-carboxylate (PubChem CID 7380780) has the molecular formula C17H22N3O3S+ and a molecular weight of 348.45 g/mol. Its IUPAC name is methyl 5-methyl-3-[(2-thiomorpholin-4-ium-4-ylacetyl)amino]-1H-indole-2-carboxylate.
| Compound Name | methyl 5-methyl-3-[(2-thiomorpholin-4-ium-4-ylacetyl)amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7380780 |
| Molecular Formula | C17H22N3O3S+ |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | methyl 5-methyl-3-[(2-thiomorpholin-4-ium-4-ylacetyl)amino]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccc(C)cc2c1NC(=O)C[NH+]1CCSCC1 |
| InChI | InChI=1S/C17H21N3O3S/c1-11-3-4-13-12(9-11)15(16(18-13)17(22)23-2)19-14(21)10-20-5-7-24-8-6-20/h3-4,9,18H,5-8,10H2,1-2H3,(H,19,21)/p+1 |
| InChIKey | PFHOLCMZKNBISR-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |