C23H27N4O3+ — CID 7528545
methyl 6-methyl-3-[[2-(4-phenylpiperazin-1-ium-1-yl)acetyl]amino]-1H-indole-2-carboxylate (PubChem CID 7528545) has the molecular formula C23H27N4O3+ and a molecular weight of 407.49 g/mol. Its IUPAC name is methyl 6-methyl-3-[[2-(4-phenylpiperazin-1-ium-1-yl)acetyl]amino]-1H-indole-2-carboxylate.
| Compound Name | methyl 6-methyl-3-[[2-(4-phenylpiperazin-1-ium-1-yl)acetyl]amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 7528545 |
| Molecular Formula | C23H27N4O3+ |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | methyl 6-methyl-3-[[2-(4-phenylpiperazin-1-ium-1-yl)acetyl]amino]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(C)ccc2c1NC(=O)C[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N4O3/c1-16-8-9-18-19(14-16)24-22(23(29)30-2)21(18)25-20(28)15-26-10-12-27(13-11-26)17-6-4-3-5-7-17/h3-9,14,24H,10-13,15H2,1-2H3,(H,25,28)/p+1 |
| InChIKey | TVDKFCDREKTKKC-UHFFFAOYSA-O |
| XLogP | 1.61 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |