C20H27N3O3 — CID 2007878
methyl 3-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-6-methyl-1H-indole-2-carboxylate (PubChem CID 2007878) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 3-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-6-methyl-1H-indole-2-carboxylate.
| Compound Name | methyl 3-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-6-methyl-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 2007878 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | methyl 3-[[2-[(2S)-2-ethylpiperidin-1-yl]acetyl]amino]-6-methyl-1H-indole-2-carboxylate |
| SMILES | CC[C@H]1CCCCN1CC(=O)Nc1c(C(=O)OC)[nH]c2cc(C)ccc12 |
| InChI | InChI=1S/C20H27N3O3/c1-4-14-7-5-6-10-23(14)12-17(24)22-18-15-9-8-13(2)11-16(15)21-19(18)20(25)26-3/h8-9,11,14,21H,4-7,10,12H2,1-3H3,(H,22,24)/t14-/m0/s1 |
| InChIKey | AFECPOFTADUBOL-AWEZNQCLSA-N |
| XLogP | 3.47 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |