C18H26N3O4+ — CID 6944330
[2-[(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)amino]-2-oxoethyl]-diethylazanium (PubChem CID 6944330) has the molecular formula C18H26N3O4+ and a molecular weight of 348.42 g/mol. Its IUPAC name is [2-[(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)amino]-2-oxoethyl]-diethylazanium.
| Compound Name | [2-[(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)amino]-2-oxoethyl]-diethylazanium |
|---|---|
| PubChem CID | 6944330 |
| Molecular Formula | C18H26N3O4+ |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | [2-[(2-ethoxycarbonyl-5-methoxy-1H-indol-3-yl)amino]-2-oxoethyl]-diethylazanium |
| SMILES | CCOC(=O)c1[nH]c2ccc(OC)cc2c1NC(=O)C[NH+](CC)CC |
| InChI | InChI=1S/C18H25N3O4/c1-5-21(6-2)11-15(22)20-16-13-10-12(24-4)8-9-14(13)19-17(16)18(23)25-7-3/h8-10,19H,5-7,11H2,1-4H3,(H,20,22)/p+1 |
| InChIKey | QTLGVGYYBPOPPZ-UHFFFAOYSA-O |
| XLogP | 1.22 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |