C19H27N3O6 — CID 4207566
ethyl 3-[[2-[2,2-dimethoxyethyl(methyl)amino]acetyl]amino]-5-methoxy-1H-indole-2-carboxylate (PubChem CID 4207566) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is ethyl 3-[[2-[2,2-dimethoxyethyl(methyl)amino]acetyl]amino]-5-methoxy-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[[2-[2,2-dimethoxyethyl(methyl)amino]acetyl]amino]-5-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4207566 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | ethyl 3-[[2-[2,2-dimethoxyethyl(methyl)amino]acetyl]amino]-5-methoxy-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(OC)cc2c1NC(=O)CN(C)CC(OC)OC |
| InChI | InChI=1S/C19H27N3O6/c1-6-28-19(24)18-17(13-9-12(25-3)7-8-14(13)20-18)21-15(23)10-22(2)11-16(26-4)27-5/h7-9,16,20H,6,10-11H2,1-5H3,(H,21,23) |
| InChIKey | DJKSFLMZFLVIRU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 102.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|