C26H31N3O4 — CID 3470366
ethyl 3-[[2-(4-benzylpiperidin-1-yl)acetyl]amino]-5-methoxy-1H-indole-2-carboxylate (PubChem CID 3470366) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is ethyl 3-[[2-(4-benzylpiperidin-1-yl)acetyl]amino]-5-methoxy-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-[[2-(4-benzylpiperidin-1-yl)acetyl]amino]-5-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 3470366 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | ethyl 3-[[2-(4-benzylpiperidin-1-yl)acetyl]amino]-5-methoxy-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(OC)cc2c1NC(=O)CN1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O4/c1-3-33-26(31)25-24(21-16-20(32-2)9-10-22(21)27-25)28-23(30)17-29-13-11-19(12-14-29)15-18-7-5-4-6-8-18/h4-10,16,19,27H,3,11-15,17H2,1-2H3,(H,28,30) |
| InChIKey | YZTOYQSOIROUIO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |