C21H29N3O4 — CID 3900647
ethyl 5-ethoxy-3-[[2-(4-methylpiperidin-1-yl)acetyl]amino]-1H-indole-2-carboxylate (PubChem CID 3900647) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl 5-ethoxy-3-[[2-(4-methylpiperidin-1-yl)acetyl]amino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-ethoxy-3-[[2-(4-methylpiperidin-1-yl)acetyl]amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 3900647 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | ethyl 5-ethoxy-3-[[2-(4-methylpiperidin-1-yl)acetyl]amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(OCC)cc2c1NC(=O)CN1CCC(C)CC1 |
| InChI | InChI=1S/C21H29N3O4/c1-4-27-15-6-7-17-16(12-15)19(20(22-17)21(26)28-5-2)23-18(25)13-24-10-8-14(3)9-11-24/h6-7,12,14,22H,4-5,8-11,13H2,1-3H3,(H,23,25) |
| InChIKey | HKCNNXQBKUYTBT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |