C24H28N4O4 — CID 4678285
methyl 3-[[2-(4-benzylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate (PubChem CID 4678285) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 3-[[2-(4-benzylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-benzylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4678285 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl 3-[[2-(4-benzylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)ccc2c1NC(=O)CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N4O4/c1-31-18-8-9-19-20(14-18)25-23(24(30)32-2)22(19)26-21(29)16-28-12-10-27(11-13-28)15-17-6-4-3-5-7-17/h3-9,14,25H,10-13,15-16H2,1-2H3,(H,26,29) |
| InChIKey | DGMARPYRGNLGJY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |