C24H27FN4O3 — CID 4678245
methyl 3-[3-(4-benzylpiperazin-1-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate (PubChem CID 4678245) has the molecular formula C24H27FN4O3 and a molecular weight of 438.50 g/mol. Its IUPAC name is methyl 3-[3-(4-benzylpiperazin-1-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate.
| Compound Name | methyl 3-[3-(4-benzylpiperazin-1-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4678245 |
| Molecular Formula | C24H27FN4O3 |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | methyl 3-[3-(4-benzylpiperazin-1-yl)propanoylamino]-5-fluoro-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccc(F)cc2c1NC(=O)CCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H27FN4O3/c1-32-24(31)23-22(19-15-18(25)7-8-20(19)26-23)27-21(30)9-10-28-11-13-29(14-12-28)16-17-5-3-2-4-6-17/h2-8,15,26H,9-14,16H2,1H3,(H,27,30) |
| InChIKey | FMGNENURFWVUCY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |