C19H19N3O3S — CID 5135430
methyl 3-(benzylcarbamothioylamino)-6-methoxy-1H-indole-2-carboxylate (PubChem CID 5135430) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is methyl 3-(benzylcarbamothioylamino)-6-methoxy-1H-indole-2-carboxylate.
| Compound Name | methyl 3-(benzylcarbamothioylamino)-6-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 5135430 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | methyl 3-(benzylcarbamothioylamino)-6-methoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)ccc2c1NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C19H19N3O3S/c1-24-13-8-9-14-15(10-13)21-17(18(23)25-2)16(14)22-19(26)20-11-12-6-4-3-5-7-12/h3-10,21H,11H2,1-2H3,(H2,20,22,26) |
| InChIKey | LPSMTDZZMCEMQQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|