C23H20N2O2S — CID 22513803
N-benzyl-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide (PubChem CID 22513803) has the molecular formula C23H20N2O2S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-benzyl-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide.
| Compound Name | N-benzyl-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 22513803 |
| Molecular Formula | C23H20N2O2S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-benzyl-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc2c(Sc3ccccc3)c(C(=O)NCc3ccccc3)[nH]c2c1 |
| InChI | InChI=1S/C23H20N2O2S/c1-27-17-12-13-19-20(14-17)25-21(22(19)28-18-10-6-3-7-11-18)23(26)24-15-16-8-4-2-5-9-16/h2-14,25H,15H2,1H3,(H,24,26) |
| InChIKey | MNANRYLPCWBXJT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |