C28H29N3O2S — CID 22513831
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide (PubChem CID 22513831) has the molecular formula C28H29N3O2S and a molecular weight of 471.63 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 22513831 |
| Molecular Formula | C28H29N3O2S |
| Molecular Weight | 471.63 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]-6-methoxy-3-phenylsulfanyl-1H-indole-2-carboxamide |
| SMILES | COc1ccc2c(Sc3ccccc3)c(C(=O)NCCCN3CCc4ccccc4C3)[nH]c2c1 |
| InChI | InChI=1S/C28H29N3O2S/c1-33-22-12-13-24-25(18-22)30-26(27(24)34-23-10-3-2-4-11-23)28(32)29-15-7-16-31-17-14-20-8-5-6-9-21(20)19-31/h2-6,8-13,18,30H,7,14-17,19H2,1H3,(H,29,32) |
| InChIKey | RXQRTWKODVKZJA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.63 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|