C30H32N4O4 — CID 4019750
methyl 3-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate (PubChem CID 4019750) has the molecular formula C30H32N4O4 and a molecular weight of 512.61 g/mol. Its IUPAC name is methyl 3-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate.
| Compound Name | methyl 3-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 4019750 |
| Molecular Formula | C30H32N4O4 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | methyl 3-[[2-(4-benzhydrylpiperazin-1-yl)acetyl]amino]-6-methoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)ccc2c1NC(=O)CN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H32N4O4/c1-37-23-13-14-24-25(19-23)31-28(30(36)38-2)27(24)32-26(35)20-33-15-17-34(18-16-33)29(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-14,19,29,31H,15-18,20H2,1-2H3,(H,32,35) |
| InChIKey | QEYYGOFVCOGNSE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |