C25H30N4O5 — CID 40954922
methyl 6-methoxy-3-[[2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]acetyl]amino]-1H-indole-2-carboxylate (PubChem CID 40954922) has the molecular formula C25H30N4O5 and a molecular weight of 466.54 g/mol. Its IUPAC name is methyl 6-methoxy-3-[[2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]acetyl]amino]-1H-indole-2-carboxylate.
| Compound Name | methyl 6-methoxy-3-[[2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]acetyl]amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 40954922 |
| Molecular Formula | C25H30N4O5 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | methyl 6-methoxy-3-[[2-[(3S)-4-(4-methoxyphenyl)-3-methylpiperazin-1-yl]acetyl]amino]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)ccc2c1NC(=O)CN1CCN(c2ccc(OC)cc2)[C@@H](C)C1 |
| InChI | InChI=1S/C25H30N4O5/c1-16-14-28(11-12-29(16)17-5-7-18(32-2)8-6-17)15-22(30)27-23-20-10-9-19(33-3)13-21(20)26-24(23)25(31)34-4/h5-10,13,16,26H,11-12,14-15H2,1-4H3,(H,27,30)/t16-/m0/s1 |
| InChIKey | RVEYCJJLEHCPEM-INIZCTEOSA-N |
| XLogP | 3.12 |
| TPSA | 96.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|