C20H27N3O4 — CID 3772154
methyl 6-methoxy-3-[2-(3-methylpiperidin-1-yl)propanoylamino]-1H-indole-2-carboxylate (PubChem CID 3772154) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is methyl 6-methoxy-3-[2-(3-methylpiperidin-1-yl)propanoylamino]-1H-indole-2-carboxylate.
| Compound Name | methyl 6-methoxy-3-[2-(3-methylpiperidin-1-yl)propanoylamino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 3772154 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | methyl 6-methoxy-3-[2-(3-methylpiperidin-1-yl)propanoylamino]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc(OC)ccc2c1NC(=O)C(C)N1CCCC(C)C1 |
| InChI | InChI=1S/C20H27N3O4/c1-12-6-5-9-23(11-12)13(2)19(24)22-17-15-8-7-14(26-3)10-16(15)21-18(17)20(25)27-4/h7-8,10,12-13,21H,5-6,9,11H2,1-4H3,(H,22,24) |
| InChIKey | WYBGZMDVIQTODN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |