C25H27N4O4+ — CID 6985611
ethyl 5-methoxy-3-[[2-(2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-2-yl)acetyl]amino]-1H-indole-2-carboxylate (PubChem CID 6985611) has the molecular formula C25H27N4O4+ and a molecular weight of 447.52 g/mol. Its IUPAC name is ethyl 5-methoxy-3-[[2-(2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-2-yl)acetyl]amino]-1H-indole-2-carboxylate.
| Compound Name | ethyl 5-methoxy-3-[[2-(2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-2-yl)acetyl]amino]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 6985611 |
| Molecular Formula | C25H27N4O4+ |
| Molecular Weight | 447.52 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | ethyl 5-methoxy-3-[[2-(2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indol-2-ium-2-yl)acetyl]amino]-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccc(OC)cc2c1NC(=O)C[NH+]1CCc2[nH]c3ccccc3c2C1 |
| InChI | InChI=1S/C25H26N4O4/c1-3-33-25(31)24-23(17-12-15(32-2)8-9-20(17)27-24)28-22(30)14-29-11-10-21-18(13-29)16-6-4-5-7-19(16)26-21/h4-9,12,26-27H,3,10-11,13-14H2,1-2H3,(H,28,30)/p+1 |
| InChIKey | JHBXZELQSVQKLY-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|